191-24-2 Benzo[ghi]perylene
| název vyrobku |
Benzo[ghi]perylene |
| Anglicky název |
Benzo[ghi]perylene; 1,12-Benzoperylene; Benzo[ghi]perylene (purity); benzo(g h i)perylene |
| Molekulární vzorec |
C22H12 |
| Molekulová hmotnost |
276.3307 |
| InChI |
InChI=1/C22H12/c1-3-13-7-9-15-11-12-16-10-8-14-4-2-6-18-17(5-1)19(13)21(15)22(16)20(14)18/h1-12H |
| Registra?ní ?íslo CAS |
191-24-2 |
| EINECS |
205-883-8 |
| Molekulární struktura |
|
| Hustota |
1.378g/cm3 |
| Bod tání |
276-280℃ |
| Bod varu |
501°C at 760 mmHg |
| Index lomu |
2.009 |
| Bod vzplanutí |
247.2°C |
| Tlak par |
1.12E-09mmHg at 25°C |
| Symbol? nebezpe?nosti |
Xn:Harmful;
|
| Riziko Codes |
R40:Possible risks of irreversible effects.;
|
| Bezpe?nostní Popis |
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|